C11H20N2O4 — CID 114006844
2-hydroxy-4-[(3-methylpiperidine-3-carbonyl)amino]butanoic acid (PubChem CID 114006844) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-hydroxy-4-[(3-methylpiperidine-3-carbonyl)amino]butanoic acid.
| Compound Name | 2-hydroxy-4-[(3-methylpiperidine-3-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 114006844 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 2-hydroxy-4-[(3-methylpiperidine-3-carbonyl)amino]butanoic acid |
| SMILES | CC1(C(=O)NCCC(O)C(=O)O)CCCNC1 |
| InChI | InChI=1S/C11H20N2O4/c1-11(4-2-5-12-7-11)10(17)13-6-3-8(14)9(15)16/h8,12,14H,2-7H2,1H3,(H,13,17)(H,15,16) |
| InChIKey | RACMBBZSXBHRSH-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |