About N,N-bis(ethenyl)ethanamine
N,N-bis(ethenyl)ethanamine (PubChem CID 11400731) has the molecular formula C6H11N
and a molecular weight of 97.16 g/mol. Its IUPAC name is N,N-bis(ethenyl)ethanamine.
Molecular Properties
| Compound Name | N,N-bis(ethenyl)ethanamine |
| PubChem CID | 11400731 |
| Molecular Formula | C6H11N |
| Molecular Weight | 97.16 g/mol |
| Exact Mass | 97.09 |
| IUPAC Name | N,N-bis(ethenyl)ethanamine |
| SMILES | C=CN(C=C)CC |
| InChI | InChI=1S/C6H11N/c1-4-7(5-2)6-3/h4-5H,1-2,6H2,3H3 |
| InChIKey | TVYQYOWWDPJXTI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.16 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-bis(ethenyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(ethenyl)ethanamine?
The IUPAC name of N,N-bis(ethenyl)ethanamine (CID 11400731) is N,N-bis(ethenyl)ethanamine.
What is the SMILES notation for N,N-bis(ethenyl)ethanamine?
The canonical SMILES for N,N-bis(ethenyl)ethanamine is C=CN(C=C)CC.
What is the InChIKey of N,N-bis(ethenyl)ethanamine?
The InChIKey is TVYQYOWWDPJXTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N/c1-4-7(5-2)6-3/h4-5H,1-2,6H2,3H3.
What are the key properties of N,N-bis(ethenyl)ethanamine?
N,N-bis(ethenyl)ethanamine has a molecular weight of 97.16 g/mol, XLogP of 1.60, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(ethenyl)ethanamine is sourced from PubChem (CID 11400731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).