C13H24N2O4 — CID 114007496
(2S)-2-hydroxy-4-[(4-methylcyclohexyl)methylcarbamoylamino]butanoic acid (PubChem CID 114007496) has the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. Its IUPAC name is (2S)-2-hydroxy-4-[(4-methylcyclohexyl)methylcarbamoylamino]butanoic acid.
| Compound Name | (2S)-2-hydroxy-4-[(4-methylcyclohexyl)methylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 114007496 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | (2S)-2-hydroxy-4-[(4-methylcyclohexyl)methylcarbamoylamino]butanoic acid |
| SMILES | CC1CCC(CNC(=O)NCC[C@H](O)C(=O)O)CC1 |
| InChI | InChI=1S/C13H24N2O4/c1-9-2-4-10(5-3-9)8-15-13(19)14-7-6-11(16)12(17)18/h9-11,16H,2-8H2,1H3,(H,17,18)(H2,14,15,19)/t9?,10?,11-/m0/s1 |
| InChIKey | HPUUGPNZBVCOCX-ILDUYXDCSA-N |
| XLogP | 0.95 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |