C11H13N3O3 — CID 114007840
3-[2-(2-aminoethoxy)phenyl]imidazolidine-2,4-dione (PubChem CID 114007840) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 3-[2-(2-aminoethoxy)phenyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-(2-aminoethoxy)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 114007840 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 3-[2-(2-aminoethoxy)phenyl]imidazolidine-2,4-dione |
| SMILES | NCCOc1ccccc1N1C(=O)CNC1=O |
| InChI | InChI=1S/C11H13N3O3/c12-5-6-17-9-4-2-1-3-8(9)14-10(15)7-13-11(14)16/h1-4H,5-7,12H2,(H,13,16) |
| InChIKey | LTKGSUZDXKGVEB-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|