C10H11N3O4S — CID 114007854
4-[2-(2,5-dioxoimidazolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid (PubChem CID 114007854) has the molecular formula C10H11N3O4S and a molecular weight of 269.28 g/mol. Its IUPAC name is 4-[2-(2,5-dioxoimidazolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid.
| Compound Name | 4-[2-(2,5-dioxoimidazolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid |
|---|---|
| PubChem CID | 114007854 |
| Molecular Formula | C10H11N3O4S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 4-[2-(2,5-dioxoimidazolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid |
| SMILES | O=C(O)CCCc1csc(N2C(=O)CNC2=O)n1 |
| InChI | InChI=1S/C10H11N3O4S/c14-7-4-11-9(17)13(7)10-12-6(5-18-10)2-1-3-8(15)16/h5H,1-4H2,(H,11,17)(H,15,16) |
| InChIKey | WOOKVPXZEZGNKU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|