About 4-[2-(2,5-dioxoimidazolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid
4-[2-(2,5-dioxoimidazolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid (PubChem CID 114007854) has the molecular formula C10H11N3O4S
and a molecular weight of 269.28 g/mol. Its IUPAC name is 4-[2-(2,5-dioxoimidazolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid.
Molecular Properties
| Compound Name | 4-[2-(2,5-dioxoimidazolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid |
| PubChem CID | 114007854 |
| Molecular Formula | C10H11N3O4S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 4-[2-(2,5-dioxoimidazolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid |
| SMILES | O=C(O)CCCc1csc(N2C(=O)CNC2=O)n1 |
| InChI | InChI=1S/C10H11N3O4S/c14-7-4-11-9(17)13(7)10-12-6(5-18-10)2-1-3-8(15)16/h5H,1-4H2,(H,11,17)(H,15,16) |
| InChIKey | WOOKVPXZEZGNKU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(2,5-dioxoimidazolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,5-dioxoimidazolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid?
The IUPAC name of 4-[2-(2,5-dioxoimidazolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid (CID 114007854) is 4-[2-(2,5-dioxoimidazolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid.
What is the SMILES notation for 4-[2-(2,5-dioxoimidazolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid?
The canonical SMILES for 4-[2-(2,5-dioxoimidazolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid is O=C(O)CCCc1csc(N2C(=O)CNC2=O)n1.
What is the InChIKey of 4-[2-(2,5-dioxoimidazolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid?
The InChIKey is WOOKVPXZEZGNKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O4S/c14-7-4-11-9(17)13(7)10-12-6(5-18-10)2-1-3-8(15)16/h5H,1-4H2,(H,11,17)(H,15,16).
What are the key properties of 4-[2-(2,5-dioxoimidazolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid?
4-[2-(2,5-dioxoimidazolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid has a molecular weight of 269.28 g/mol, XLogP of 0.61, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,5-dioxoimidazolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid is sourced from PubChem (CID 114007854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).