C11H15BrN2O4 — CID 114008008
3-amino-2-bromo-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]benzamide (PubChem CID 114008008) has the molecular formula C11H15BrN2O4 and a molecular weight of 319.16 g/mol. Its IUPAC name is 3-amino-2-bromo-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]benzamide.
| Compound Name | 3-amino-2-bromo-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 114008008 |
| Molecular Formula | C11H15BrN2O4 |
| Molecular Weight | 319.16 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 3-amino-2-bromo-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]benzamide |
| SMILES | Nc1cccc(C(=O)NC(CO)(CO)CO)c1Br |
| InChI | InChI=1S/C11H15BrN2O4/c12-9-7(2-1-3-8(9)13)10(18)14-11(4-15,5-16)6-17/h1-3,15-17H,4-6,13H2,(H,14,18) |
| InChIKey | PYLQGSYROBGMGQ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.16 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|