About 3-ethyl-5,6-dihydro-4H-oxazine-6-carbonitrile
3-ethyl-5,6-dihydro-4H-oxazine-6-carbonitrile (PubChem CID 11400808) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is 3-ethyl-5,6-dihydro-4H-oxazine-6-carbonitrile.
Molecular Properties
| Compound Name | 3-ethyl-5,6-dihydro-4H-oxazine-6-carbonitrile |
| PubChem CID | 11400808 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 3-ethyl-5,6-dihydro-4H-oxazine-6-carbonitrile |
| SMILES | CCC1=NOC(C#N)CC1 |
| InChI | InChI=1S/C7H10N2O/c1-2-6-3-4-7(5-8)10-9-6/h7H,2-4H2,1H3 |
| InChIKey | SXCBTMTZSYCKQH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-5,6-dihydro-4H-oxazine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5,6-dihydro-4H-oxazine-6-carbonitrile?
The IUPAC name of 3-ethyl-5,6-dihydro-4H-oxazine-6-carbonitrile (CID 11400808) is 3-ethyl-5,6-dihydro-4H-oxazine-6-carbonitrile.
What is the SMILES notation for 3-ethyl-5,6-dihydro-4H-oxazine-6-carbonitrile?
The canonical SMILES for 3-ethyl-5,6-dihydro-4H-oxazine-6-carbonitrile is CCC1=NOC(C#N)CC1.
What is the InChIKey of 3-ethyl-5,6-dihydro-4H-oxazine-6-carbonitrile?
The InChIKey is SXCBTMTZSYCKQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c1-2-6-3-4-7(5-8)10-9-6/h7H,2-4H2,1H3.
What are the key properties of 3-ethyl-5,6-dihydro-4H-oxazine-6-carbonitrile?
3-ethyl-5,6-dihydro-4H-oxazine-6-carbonitrile has a molecular weight of 138.17 g/mol, XLogP of 1.45, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5,6-dihydro-4H-oxazine-6-carbonitrile is sourced from PubChem (CID 11400808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).