C8H18F3N3O2S — CID 114008122
N'-(2,2,2-trifluoroethylsulfamoyl)hexane-1,6-diamine (PubChem CID 114008122) has the molecular formula C8H18F3N3O2S and a molecular weight of 277.31 g/mol. Its IUPAC name is N'-(2,2,2-trifluoroethylsulfamoyl)hexane-1,6-diamine.
| Compound Name | N'-(2,2,2-trifluoroethylsulfamoyl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 114008122 |
| Molecular Formula | C8H18F3N3O2S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | N'-(2,2,2-trifluoroethylsulfamoyl)hexane-1,6-diamine |
| SMILES | NCCCCCCNS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H18F3N3O2S/c9-8(10,11)7-14-17(15,16)13-6-4-2-1-3-5-12/h13-14H,1-7,12H2 |
| InChIKey | HNBZBXHWEZBJTA-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|