C13H24N4O — CID 114008164
N'-(4-propan-2-yloxypyrimidin-2-yl)hexane-1,6-diamine (PubChem CID 114008164) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is N'-(4-propan-2-yloxypyrimidin-2-yl)hexane-1,6-diamine.
| Compound Name | N'-(4-propan-2-yloxypyrimidin-2-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 114008164 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | N'-(4-propan-2-yloxypyrimidin-2-yl)hexane-1,6-diamine |
| SMILES | CC(C)Oc1ccnc(NCCCCCCN)n1 |
| InChI | InChI=1S/C13H24N4O/c1-11(2)18-12-7-10-16-13(17-12)15-9-6-4-3-5-8-14/h7,10-11H,3-6,8-9,14H2,1-2H3,(H,15,16,17) |
| InChIKey | IBQIUGMXPGUYOT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|