C4H8N6O — CID 11400900
2-N-methoxy-1,3,5-triazine-2,4,6-triamine (PubChem CID 11400900) has the molecular formula C4H8N6O and a molecular weight of 156.15 g/mol. Its IUPAC name is 2-N-methoxy-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-methoxy-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 11400900 |
| Molecular Formula | C4H8N6O |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 2-N-methoxy-1,3,5-triazine-2,4,6-triamine |
| SMILES | CONc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C4H8N6O/c1-11-10-4-8-2(5)7-3(6)9-4/h1H3,(H5,5,6,7,8,9,10) |
| InChIKey | BLRJSXFWDNMKQT-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|