C8H12O3 — CID 11400901
(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enal (PubChem CID 11400901) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is (E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enal.
| Compound Name | (E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enal |
|---|---|
| PubChem CID | 11400901 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enal |
| SMILES | CC1(C)OC[C@H](/C=C/C=O)O1 |
| InChI | InChI=1S/C8H12O3/c1-8(2)10-6-7(11-8)4-3-5-9/h3-5,7H,6H2,1-2H3/b4-3+/t7-/m0/s1 |
| InChIKey | WVXUAVWQSVCSQF-SDLBARTOSA-N |
| XLogP | 0.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|