C12H25N3O2 — CID 114009285
N'-hydroxy-2-[1-[(6-hydroxyhexylamino)methyl]cyclopropyl]ethanimidamide (PubChem CID 114009285) has the molecular formula C12H25N3O2 and a molecular weight of 243.35 g/mol. Its IUPAC name is N'-hydroxy-2-[1-[(6-hydroxyhexylamino)methyl]cyclopropyl]ethanimidamide.
| Compound Name | N'-hydroxy-2-[1-[(6-hydroxyhexylamino)methyl]cyclopropyl]ethanimidamide |
|---|---|
| PubChem CID | 114009285 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | N'-hydroxy-2-[1-[(6-hydroxyhexylamino)methyl]cyclopropyl]ethanimidamide |
| SMILES | NC(CC1(CNCCCCCCO)CC1)=NO |
| InChI | InChI=1S/C12H25N3O2/c13-11(15-17)9-12(5-6-12)10-14-7-3-1-2-4-8-16/h14,16-17H,1-10H2,(H2,13,15) |
| InChIKey | ZSXHBYONAFWCGG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|