C12H22N4O — CID 114009519
6-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]hexan-1-ol (PubChem CID 114009519) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is 6-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]hexan-1-ol.
| Compound Name | 6-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]hexan-1-ol |
|---|---|
| PubChem CID | 114009519 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 6-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]hexan-1-ol |
| SMILES | Cc1nc(N)c(C)c(NCCCCCCO)n1 |
| InChI | InChI=1S/C12H22N4O/c1-9-11(13)15-10(2)16-12(9)14-7-5-3-4-6-8-17/h17H,3-8H2,1-2H3,(H3,13,14,15,16) |
| InChIKey | VVXXJIIGFWHTNS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|