About 6-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]hexan-1-ol
6-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]hexan-1-ol (PubChem CID 114009519) has the molecular formula C12H22N4O
and a molecular weight of 238.33 g/mol. Its IUPAC name is 6-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]hexan-1-ol.
Molecular Properties
| Compound Name | 6-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]hexan-1-ol |
| PubChem CID | 114009519 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 6-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]hexan-1-ol |
| SMILES | Cc1nc(N)c(C)c(NCCCCCCO)n1 |
| InChI | InChI=1S/C12H22N4O/c1-9-11(13)15-10(2)16-12(9)14-7-5-3-4-6-8-17/h17H,3-8H2,1-2H3,(H3,13,14,15,16) |
| InChIKey | VVXXJIIGFWHTNS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]hexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]hexan-1-ol?
The IUPAC name of 6-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]hexan-1-ol (CID 114009519) is 6-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]hexan-1-ol.
What is the SMILES notation for 6-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]hexan-1-ol?
The canonical SMILES for 6-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]hexan-1-ol is Cc1nc(N)c(C)c(NCCCCCCO)n1.
What is the InChIKey of 6-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]hexan-1-ol?
The InChIKey is VVXXJIIGFWHTNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O/c1-9-11(13)15-10(2)16-12(9)14-7-5-3-4-6-8-17/h17H,3-8H2,1-2H3,(H3,13,14,15,16).
What are the key properties of 6-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]hexan-1-ol?
6-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]hexan-1-ol has a molecular weight of 238.33 g/mol, XLogP of 1.64, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]hexan-1-ol is sourced from PubChem (CID 114009519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).