C13H24N4O — CID 114009544
6-[[2-ethyl-6-(methylamino)pyrimidin-4-yl]amino]hexan-1-ol (PubChem CID 114009544) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is 6-[[2-ethyl-6-(methylamino)pyrimidin-4-yl]amino]hexan-1-ol.
| Compound Name | 6-[[2-ethyl-6-(methylamino)pyrimidin-4-yl]amino]hexan-1-ol |
|---|---|
| PubChem CID | 114009544 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 6-[[2-ethyl-6-(methylamino)pyrimidin-4-yl]amino]hexan-1-ol |
| SMILES | CCc1nc(NC)cc(NCCCCCCO)n1 |
| InChI | InChI=1S/C13H24N4O/c1-3-11-16-12(14-2)10-13(17-11)15-8-6-4-5-7-9-18/h10,18H,3-9H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | ODOKBWHJHQJQEY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|