C12H21N3OS — CID 114009580
6-[(3-amino-4-cyclopropyl-1,2-thiazol-5-yl)amino]hexan-1-ol (PubChem CID 114009580) has the molecular formula C12H21N3OS and a molecular weight of 255.39 g/mol. Its IUPAC name is 6-[(3-amino-4-cyclopropyl-1,2-thiazol-5-yl)amino]hexan-1-ol.
| Compound Name | 6-[(3-amino-4-cyclopropyl-1,2-thiazol-5-yl)amino]hexan-1-ol |
|---|---|
| PubChem CID | 114009580 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 6-[(3-amino-4-cyclopropyl-1,2-thiazol-5-yl)amino]hexan-1-ol |
| SMILES | Nc1nsc(NCCCCCCO)c1C1CC1 |
| InChI | InChI=1S/C12H21N3OS/c13-11-10(9-5-6-9)12(17-15-11)14-7-3-1-2-4-8-16/h9,14,16H,1-8H2,(H2,13,15) |
| InChIKey | NDFDKHIQGGVEEU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|