C10H17NO — CID 11400993
(5R,7R,8aS)-5,7-dimethyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 11400993) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (5R,7R,8aS)-5,7-dimethyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (5R,7R,8aS)-5,7-dimethyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 11400993 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (5R,7R,8aS)-5,7-dimethyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | C[C@H]1C[C@@H]2CCC(=O)N2[C@H](C)C1 |
| InChI | InChI=1S/C10H17NO/c1-7-5-8(2)11-9(6-7)3-4-10(11)12/h7-9H,3-6H2,1-2H3/t7-,8-,9+/m1/s1 |
| InChIKey | WKJNGSQWLNBWEB-HLTSFMKQSA-N |
| XLogP | 1.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |