C13H18N2O3 — CID 114010288
4-hydroxy-N-[(1R)-2-hydroxy-1-phenylethyl]pyrrolidine-2-carboxamide (PubChem CID 114010288) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 4-hydroxy-N-[(1R)-2-hydroxy-1-phenylethyl]pyrrolidine-2-carboxamide.
| Compound Name | 4-hydroxy-N-[(1R)-2-hydroxy-1-phenylethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 114010288 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 4-hydroxy-N-[(1R)-2-hydroxy-1-phenylethyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(N[C@@H](CO)c1ccccc1)C1CC(O)CN1 |
| InChI | InChI=1S/C13H18N2O3/c16-8-12(9-4-2-1-3-5-9)15-13(18)11-6-10(17)7-14-11/h1-5,10-12,14,16-17H,6-8H2,(H,15,18)/t10?,11?,12-/m0/s1 |
| InChIKey | VXJRABUCXKZDRQ-MCIGGMRASA-N |
| XLogP | -0.44 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |