C10H10N2O — CID 11401051
(2Z)-2-benzylidene-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 11401051) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is (2Z)-2-benzylidene-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | (2Z)-2-benzylidene-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 11401051 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | (2Z)-2-benzylidene-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | [O-]C1=N/[N+](=C\c2ccccc2)CC1 |
| InChI | InChI=1S/C10H10N2O/c13-10-6-7-12(11-10)8-9-4-2-1-3-5-9/h1-5,8H,6-7H2/b12-8- |
| InChIKey | BKFOLPLGOGKAKR-WQLSENKSSA-N |
| XLogP | 0.20 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|