C13H17Cl2N3S — CID 114010801
N-[1-chloro-2-(chloromethyl)butan-2-yl]-6-ethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 114010801) has the molecular formula C13H17Cl2N3S and a molecular weight of 318.27 g/mol. Its IUPAC name is N-[1-chloro-2-(chloromethyl)butan-2-yl]-6-ethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[1-chloro-2-(chloromethyl)butan-2-yl]-6-ethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 114010801 |
| Molecular Formula | C13H17Cl2N3S |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | N-[1-chloro-2-(chloromethyl)butan-2-yl]-6-ethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(NC(CC)(CCl)CCl)ncnc2s1 |
| InChI | InChI=1S/C13H17Cl2N3S/c1-3-9-5-10-11(16-8-17-12(10)19-9)18-13(4-2,6-14)7-15/h5,8H,3-4,6-7H2,1-2H3,(H,16,17,18) |
| InChIKey | BRDFBCSGZBJRIO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|