C11H17NO — CID 11401111
(1R,9aS)-1-methyl-7-methylidene-2,3,6,8,9,9a-hexahydro-1H-quinolizin-4-one (PubChem CID 11401111) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (1R,9aS)-1-methyl-7-methylidene-2,3,6,8,9,9a-hexahydro-1H-quinolizin-4-one.
| Compound Name | (1R,9aS)-1-methyl-7-methylidene-2,3,6,8,9,9a-hexahydro-1H-quinolizin-4-one |
|---|---|
| PubChem CID | 11401111 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (1R,9aS)-1-methyl-7-methylidene-2,3,6,8,9,9a-hexahydro-1H-quinolizin-4-one |
| SMILES | C=C1CC[C@H]2[C@H](C)CCC(=O)N2C1 |
| InChI | InChI=1S/C11H17NO/c1-8-3-5-10-9(2)4-6-11(13)12(10)7-8/h9-10H,1,3-7H2,2H3/t9-,10+/m1/s1 |
| InChIKey | UHMQFFDRYYIZML-ZJUUUORDSA-N |
| XLogP | 1.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|