About 2,4-dimethyl-3H-1,5-benzodiazepin-6-ol
2,4-dimethyl-3H-1,5-benzodiazepin-6-ol (PubChem CID 11401226) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is 2,4-dimethyl-3H-1,5-benzodiazepin-6-ol.
Molecular Properties
| Compound Name | 2,4-dimethyl-3H-1,5-benzodiazepin-6-ol |
| PubChem CID | 11401226 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 2,4-dimethyl-3H-1,5-benzodiazepin-6-ol |
| SMILES | CC1=Nc2cccc(O)c2N=C(C)C1 |
| InChI | InChI=1S/C11H12N2O/c1-7-6-8(2)13-11-9(12-7)4-3-5-10(11)14/h3-5,14H,6H2,1-2H3 |
| InChIKey | JZVDBPAQWANVJM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dimethyl-3H-1,5-benzodiazepin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-3H-1,5-benzodiazepin-6-ol?
The IUPAC name of 2,4-dimethyl-3H-1,5-benzodiazepin-6-ol (CID 11401226) is 2,4-dimethyl-3H-1,5-benzodiazepin-6-ol.
What is the SMILES notation for 2,4-dimethyl-3H-1,5-benzodiazepin-6-ol?
The canonical SMILES for 2,4-dimethyl-3H-1,5-benzodiazepin-6-ol is CC1=Nc2cccc(O)c2N=C(C)C1.
What is the InChIKey of 2,4-dimethyl-3H-1,5-benzodiazepin-6-ol?
The InChIKey is JZVDBPAQWANVJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O/c1-7-6-8(2)13-11-9(12-7)4-3-5-10(11)14/h3-5,14H,6H2,1-2H3.
What are the key properties of 2,4-dimethyl-3H-1,5-benzodiazepin-6-ol?
2,4-dimethyl-3H-1,5-benzodiazepin-6-ol has a molecular weight of 188.23 g/mol, XLogP of 2.98, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-3H-1,5-benzodiazepin-6-ol is sourced from PubChem (CID 11401226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).