C15H19FN2 — CID 114012369
5-[[cyclobutylmethyl(ethyl)amino]methyl]-2-fluorobenzonitrile (PubChem CID 114012369) has the molecular formula C15H19FN2 and a molecular weight of 246.33 g/mol. Its IUPAC name is 5-[[cyclobutylmethyl(ethyl)amino]methyl]-2-fluorobenzonitrile.
| Compound Name | 5-[[cyclobutylmethyl(ethyl)amino]methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 114012369 |
| Molecular Formula | C15H19FN2 |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 5-[[cyclobutylmethyl(ethyl)amino]methyl]-2-fluorobenzonitrile |
| SMILES | CCN(Cc1ccc(F)c(C#N)c1)CC1CCC1 |
| InChI | InChI=1S/C15H19FN2/c1-2-18(10-12-4-3-5-12)11-13-6-7-15(16)14(8-13)9-17/h6-8,12H,2-5,10-11H2,1H3 |
| InChIKey | QYNBHTZGVAIVMM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |