C15H21NS — CID 114013577
1-(1-benzothiophen-2-yl)-N,2-dimethylpentan-1-amine (PubChem CID 114013577) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is 1-(1-benzothiophen-2-yl)-N,2-dimethylpentan-1-amine.
| Compound Name | 1-(1-benzothiophen-2-yl)-N,2-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 114013577 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 1-(1-benzothiophen-2-yl)-N,2-dimethylpentan-1-amine |
| SMILES | CCCC(C)C(NC)c1cc2ccccc2s1 |
| InChI | InChI=1S/C15H21NS/c1-4-7-11(2)15(16-3)14-10-12-8-5-6-9-13(12)17-14/h5-6,8-11,15-16H,4,7H2,1-3H3 |
| InChIKey | YNZSZAQDMXOAFV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |