C10H16O4 — CID 11401383
methyl 2-[(1R,2R,3S,4S)-4-ethenyl-2,3-dihydroxycyclopentyl]acetate (PubChem CID 11401383) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is methyl 2-[(1R,2R,3S,4S)-4-ethenyl-2,3-dihydroxycyclopentyl]acetate.
| Compound Name | methyl 2-[(1R,2R,3S,4S)-4-ethenyl-2,3-dihydroxycyclopentyl]acetate |
|---|---|
| PubChem CID | 11401383 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | methyl 2-[(1R,2R,3S,4S)-4-ethenyl-2,3-dihydroxycyclopentyl]acetate |
| SMILES | C=C[C@@H]1C[C@H](CC(=O)OC)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H16O4/c1-3-6-4-7(5-8(11)14-2)10(13)9(6)12/h3,6-7,9-10,12-13H,1,4-5H2,2H3/t6-,7-,9+,10-/m1/s1 |
| InChIKey | WXOYEVYRWFLMKO-GTDKDYCYSA-N |
| XLogP | 0.09 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|