C15H24BrN — CID 114013874
2-[(4-bromophenyl)methyl]-N,3-dimethylhexan-1-amine (PubChem CID 114013874) has the molecular formula C15H24BrN and a molecular weight of 298.27 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-N,3-dimethylhexan-1-amine.
| Compound Name | 2-[(4-bromophenyl)methyl]-N,3-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 114013874 |
| Molecular Formula | C15H24BrN |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-N,3-dimethylhexan-1-amine |
| SMILES | CCCC(C)C(CNC)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H24BrN/c1-4-5-12(2)14(11-17-3)10-13-6-8-15(16)9-7-13/h6-9,12,14,17H,4-5,10-11H2,1-3H3 |
| InChIKey | GZYXQFJRLUCAHD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |