C11H7F6NO — CID 114014313
4-fluoro-2-(2,2,3,3,3-pentafluoropropoxymethyl)benzonitrile (PubChem CID 114014313) has the molecular formula C11H7F6NO and a molecular weight of 283.17 g/mol. Its IUPAC name is 4-fluoro-2-(2,2,3,3,3-pentafluoropropoxymethyl)benzonitrile.
| Compound Name | 4-fluoro-2-(2,2,3,3,3-pentafluoropropoxymethyl)benzonitrile |
|---|---|
| PubChem CID | 114014313 |
| Molecular Formula | C11H7F6NO |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 4-fluoro-2-(2,2,3,3,3-pentafluoropropoxymethyl)benzonitrile |
| SMILES | N#Cc1ccc(F)cc1COCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H7F6NO/c12-9-2-1-7(4-18)8(3-9)5-19-6-10(13,14)11(15,16)17/h1-3H,5-6H2 |
| InChIKey | DARFEBICTUQXCA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|