C12H15BrN2O3 — CID 114014328
N-[4-(3-amino-3-oxopropoxy)phenyl]-2-bromopropanamide (PubChem CID 114014328) has the molecular formula C12H15BrN2O3 and a molecular weight of 315.17 g/mol. Its IUPAC name is N-[4-(3-amino-3-oxopropoxy)phenyl]-2-bromopropanamide.
| Compound Name | N-[4-(3-amino-3-oxopropoxy)phenyl]-2-bromopropanamide |
|---|---|
| PubChem CID | 114014328 |
| Molecular Formula | C12H15BrN2O3 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | N-[4-(3-amino-3-oxopropoxy)phenyl]-2-bromopropanamide |
| SMILES | CC(Br)C(=O)Nc1ccc(OCCC(N)=O)cc1 |
| InChI | InChI=1S/C12H15BrN2O3/c1-8(13)12(17)15-9-2-4-10(5-3-9)18-7-6-11(14)16/h2-5,8H,6-7H2,1H3,(H2,14,16)(H,15,17) |
| InChIKey | NGLMPIIVCPXBAO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|