C14H20FNO2S — CID 114015298
2-[2-(4-fluorophenyl)sulfonylethyl]-1-methylpiperidine (PubChem CID 114015298) has the molecular formula C14H20FNO2S and a molecular weight of 285.38 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)sulfonylethyl]-1-methylpiperidine.
| Compound Name | 2-[2-(4-fluorophenyl)sulfonylethyl]-1-methylpiperidine |
|---|---|
| PubChem CID | 114015298 |
| Molecular Formula | C14H20FNO2S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-[2-(4-fluorophenyl)sulfonylethyl]-1-methylpiperidine |
| SMILES | CN1CCCCC1CCS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H20FNO2S/c1-16-10-3-2-4-13(16)9-11-19(17,18)14-7-5-12(15)6-8-14/h5-8,13H,2-4,9-11H2,1H3 |
| InChIKey | CESVKZDJEJRPMB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |