C13H12BrN3O — CID 114015428
N-[[3-(2-bromo-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-yn-1-amine (PubChem CID 114015428) has the molecular formula C13H12BrN3O and a molecular weight of 306.16 g/mol. Its IUPAC name is N-[[3-(2-bromo-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-yn-1-amine.
| Compound Name | N-[[3-(2-bromo-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 114015428 |
| Molecular Formula | C13H12BrN3O |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | N-[[3-(2-bromo-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-yn-1-amine |
| SMILES | C#CCNCc1nc(-c2ccc(C)cc2Br)no1 |
| InChI | InChI=1S/C13H12BrN3O/c1-3-6-15-8-12-16-13(17-18-12)10-5-4-9(2)7-11(10)14/h1,4-5,7,15H,6,8H2,2H3 |
| InChIKey | ZVGSLGHGQMQCFB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|