C13H22O2 — CID 11401566
2-(2-methylhexa-4,5-dien-3-yl)-2-prop-2-enylpropane-1,3-diol (PubChem CID 11401566) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-(2-methylhexa-4,5-dien-3-yl)-2-prop-2-enylpropane-1,3-diol.
| Compound Name | 2-(2-methylhexa-4,5-dien-3-yl)-2-prop-2-enylpropane-1,3-diol |
|---|---|
| PubChem CID | 11401566 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 2-(2-methylhexa-4,5-dien-3-yl)-2-prop-2-enylpropane-1,3-diol |
| SMILES | C=C=CC(C(C)C)C(CO)(CO)CC=C |
| InChI | InChI=1S/C13H22O2/c1-5-7-12(11(3)4)13(9-14,10-15)8-6-2/h6-7,11-12,14-15H,1-2,8-10H2,3-4H3 |
| InChIKey | VQEQAKRPUATTNR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|