About [(1R,2S,5E)-2-acetamido-5-hydroxyiminocyclopent-3-en-1-yl] acetate
[(1R,2S,5E)-2-acetamido-5-hydroxyiminocyclopent-3-en-1-yl] acetate (PubChem CID 11401587) has the molecular formula C9H12N2O4
and a molecular weight of 212.20 g/mol. Its IUPAC name is [(1R,2S,5E)-2-acetamido-5-hydroxyiminocyclopent-3-en-1-yl] acetate.
Molecular Properties
| Compound Name | [(1R,2S,5E)-2-acetamido-5-hydroxyiminocyclopent-3-en-1-yl] acetate |
| PubChem CID | 11401587 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | [(1R,2S,5E)-2-acetamido-5-hydroxyiminocyclopent-3-en-1-yl] acetate |
| SMILES | CC(=O)N[C@H]1C=C/C(=N\O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C9H12N2O4/c1-5(12)10-7-3-4-8(11-14)9(7)15-6(2)13/h3-4,7,9,14H,1-2H3,(H,10,12)/b11-8+/t7-,9+/m0/s1 |
| InChIKey | XGJBTDSPGMYKIY-PZANAEQYSA-N |
| XLogP | -0.18 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2S,5E)-2-acetamido-5-hydroxyiminocyclopent-3-en-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S,5E)-2-acetamido-5-hydroxyiminocyclopent-3-en-1-yl] acetate?
The IUPAC name of [(1R,2S,5E)-2-acetamido-5-hydroxyiminocyclopent-3-en-1-yl] acetate (CID 11401587) is [(1R,2S,5E)-2-acetamido-5-hydroxyiminocyclopent-3-en-1-yl] acetate.
What is the SMILES notation for [(1R,2S,5E)-2-acetamido-5-hydroxyiminocyclopent-3-en-1-yl] acetate?
The canonical SMILES for [(1R,2S,5E)-2-acetamido-5-hydroxyiminocyclopent-3-en-1-yl] acetate is CC(=O)N[C@H]1C=C/C(=N\O)[C@@H]1OC(C)=O.
What is the InChIKey of [(1R,2S,5E)-2-acetamido-5-hydroxyiminocyclopent-3-en-1-yl] acetate?
The InChIKey is XGJBTDSPGMYKIY-PZANAEQYSA-N. The full InChI is InChI=1S/C9H12N2O4/c1-5(12)10-7-3-4-8(11-14)9(7)15-6(2)13/h3-4,7,9,14H,1-2H3,(H,10,12)/b11-8+/t7-,9+/m0/s1.
What are the key properties of [(1R,2S,5E)-2-acetamido-5-hydroxyiminocyclopent-3-en-1-yl] acetate?
[(1R,2S,5E)-2-acetamido-5-hydroxyiminocyclopent-3-en-1-yl] acetate has a molecular weight of 212.20 g/mol, XLogP of -0.18, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S,5E)-2-acetamido-5-hydroxyiminocyclopent-3-en-1-yl] acetate is sourced from PubChem (CID 11401587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).