C13H19N3OS — CID 114017220
N'-hydroxy-5-methyl-2-(1,4-thiazepan-4-yl)benzenecarboximidamide (PubChem CID 114017220) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is N'-hydroxy-5-methyl-2-(1,4-thiazepan-4-yl)benzenecarboximidamide.
| Compound Name | N'-hydroxy-5-methyl-2-(1,4-thiazepan-4-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 114017220 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | N'-hydroxy-5-methyl-2-(1,4-thiazepan-4-yl)benzenecarboximidamide |
| SMILES | Cc1ccc(N2CCCSCC2)c(/C(N)=N/O)c1 |
| InChI | InChI=1S/C13H19N3OS/c1-10-3-4-12(11(9-10)13(14)15-17)16-5-2-7-18-8-6-16/h3-4,9,17H,2,5-8H2,1H3,(H2,14,15) |
| InChIKey | XCIYDEPJGQVBHF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|