About 6-phenyl-2,3-dihydro-1,4-dithiine-5-carbonitrile
6-phenyl-2,3-dihydro-1,4-dithiine-5-carbonitrile (PubChem CID 11401726) has the molecular formula C11H9NS2
and a molecular weight of 219.33 g/mol. Its IUPAC name is 6-phenyl-2,3-dihydro-1,4-dithiine-5-carbonitrile.
Molecular Properties
| Compound Name | 6-phenyl-2,3-dihydro-1,4-dithiine-5-carbonitrile |
| PubChem CID | 11401726 |
| Molecular Formula | C11H9NS2 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 6-phenyl-2,3-dihydro-1,4-dithiine-5-carbonitrile |
| SMILES | N#CC1=C(c2ccccc2)SCCS1 |
| InChI | InChI=1S/C11H9NS2/c12-8-10-11(14-7-6-13-10)9-4-2-1-3-5-9/h1-5H,6-7H2 |
| InChIKey | ASLVZGNRHKZGRB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-phenyl-2,3-dihydro-1,4-dithiine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyl-2,3-dihydro-1,4-dithiine-5-carbonitrile?
The IUPAC name of 6-phenyl-2,3-dihydro-1,4-dithiine-5-carbonitrile (CID 11401726) is 6-phenyl-2,3-dihydro-1,4-dithiine-5-carbonitrile.
What is the SMILES notation for 6-phenyl-2,3-dihydro-1,4-dithiine-5-carbonitrile?
The canonical SMILES for 6-phenyl-2,3-dihydro-1,4-dithiine-5-carbonitrile is N#CC1=C(c2ccccc2)SCCS1.
What is the InChIKey of 6-phenyl-2,3-dihydro-1,4-dithiine-5-carbonitrile?
The InChIKey is ASLVZGNRHKZGRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NS2/c12-8-10-11(14-7-6-13-10)9-4-2-1-3-5-9/h1-5H,6-7H2.
What are the key properties of 6-phenyl-2,3-dihydro-1,4-dithiine-5-carbonitrile?
6-phenyl-2,3-dihydro-1,4-dithiine-5-carbonitrile has a molecular weight of 219.33 g/mol, XLogP of 3.36, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyl-2,3-dihydro-1,4-dithiine-5-carbonitrile is sourced from PubChem (CID 11401726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).