C13H13F2NO2 — CID 114017923
4-(2-azabicyclo[2.2.1]heptan-2-yl)-2,3-difluorobenzoic acid (PubChem CID 114017923) has the molecular formula C13H13F2NO2 and a molecular weight of 253.25 g/mol. Its IUPAC name is 4-(2-azabicyclo[2.2.1]heptan-2-yl)-2,3-difluorobenzoic acid.
| Compound Name | 4-(2-azabicyclo[2.2.1]heptan-2-yl)-2,3-difluorobenzoic acid |
|---|---|
| PubChem CID | 114017923 |
| Molecular Formula | C13H13F2NO2 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 4-(2-azabicyclo[2.2.1]heptan-2-yl)-2,3-difluorobenzoic acid |
| SMILES | O=C(O)c1ccc(N2CC3CCC2C3)c(F)c1F |
| InChI | InChI=1S/C13H13F2NO2/c14-11-9(13(17)18)3-4-10(12(11)15)16-6-7-1-2-8(16)5-7/h3-4,7-8H,1-2,5-6H2,(H,17,18) |
| InChIKey | UETTUSMGOLTUKD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |