C12H23N5O — CID 114018304
[1-[5-(propoxymethyl)-1H-1,2,4-triazol-3-yl]piperidin-3-yl]methanamine (PubChem CID 114018304) has the molecular formula C12H23N5O and a molecular weight of 253.35 g/mol. Its IUPAC name is [1-[5-(propoxymethyl)-1H-1,2,4-triazol-3-yl]piperidin-3-yl]methanamine.
| Compound Name | [1-[5-(propoxymethyl)-1H-1,2,4-triazol-3-yl]piperidin-3-yl]methanamine |
|---|---|
| PubChem CID | 114018304 |
| Molecular Formula | C12H23N5O |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | [1-[5-(propoxymethyl)-1H-1,2,4-triazol-3-yl]piperidin-3-yl]methanamine |
| SMILES | CCCOCc1nc(N2CCCC(CN)C2)n[nH]1 |
| InChI | InChI=1S/C12H23N5O/c1-2-6-18-9-11-14-12(16-15-11)17-5-3-4-10(7-13)8-17/h10H,2-9,13H2,1H3,(H,14,15,16) |
| InChIKey | XPGBHMFGOAZWFH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|