C12H10Br2N2O3 — CID 114018570
4-[5-(2,4-dibromophenyl)-1,3,4-oxadiazol-2-yl]butanoic acid (PubChem CID 114018570) has the molecular formula C12H10Br2N2O3 and a molecular weight of 390.03 g/mol. Its IUPAC name is 4-[5-(2,4-dibromophenyl)-1,3,4-oxadiazol-2-yl]butanoic acid.
| Compound Name | 4-[5-(2,4-dibromophenyl)-1,3,4-oxadiazol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 114018570 |
| Molecular Formula | C12H10Br2N2O3 |
| Molecular Weight | 390.03 g/mol |
| Exact Mass | 387.91 |
| IUPAC Name | 4-[5-(2,4-dibromophenyl)-1,3,4-oxadiazol-2-yl]butanoic acid |
| SMILES | O=C(O)CCCc1nnc(-c2ccc(Br)cc2Br)o1 |
| InChI | InChI=1S/C12H10Br2N2O3/c13-7-4-5-8(9(14)6-7)12-16-15-10(19-12)2-1-3-11(17)18/h4-6H,1-3H2,(H,17,18) |
| InChIKey | UPJOMZAKCWAAGM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.03 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |