C12H19NOS — CID 11401861
(4R,9aS)-4-methyl-4-prop-2-enyl-1,2,7,8,9,9a-hexahydropyrrolo[1,2-d][1,4]thiazepin-5-one (PubChem CID 11401861) has the molecular formula C12H19NOS and a molecular weight of 225.36 g/mol. Its IUPAC name is (4R,9aS)-4-methyl-4-prop-2-enyl-1,2,7,8,9,9a-hexahydropyrrolo[1,2-d][1,4]thiazepin-5-one.
| Compound Name | (4R,9aS)-4-methyl-4-prop-2-enyl-1,2,7,8,9,9a-hexahydropyrrolo[1,2-d][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 11401861 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | (4R,9aS)-4-methyl-4-prop-2-enyl-1,2,7,8,9,9a-hexahydropyrrolo[1,2-d][1,4]thiazepin-5-one |
| SMILES | C=CC[C@@]1(C)SCC[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C12H19NOS/c1-3-7-12(2)11(14)13-8-4-5-10(13)6-9-15-12/h3,10H,1,4-9H2,2H3/t10-,12+/m0/s1 |
| InChIKey | HQEBUJCUCGHABB-CMPLNLGQSA-N |
| XLogP | 2.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|