C12H12Br2N2S — CID 114019360
1-(2,4-dibromophenyl)-N-methyl-2-(1,3-thiazol-5-yl)ethanamine (PubChem CID 114019360) has the molecular formula C12H12Br2N2S and a molecular weight of 376.12 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)-N-methyl-2-(1,3-thiazol-5-yl)ethanamine.
| Compound Name | 1-(2,4-dibromophenyl)-N-methyl-2-(1,3-thiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 114019360 |
| Molecular Formula | C12H12Br2N2S |
| Molecular Weight | 376.12 g/mol |
| Exact Mass | 373.91 |
| IUPAC Name | 1-(2,4-dibromophenyl)-N-methyl-2-(1,3-thiazol-5-yl)ethanamine |
| SMILES | CNC(Cc1cncs1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H12Br2N2S/c1-15-12(5-9-6-16-7-17-9)10-3-2-8(13)4-11(10)14/h2-4,6-7,12,15H,5H2,1H3 |
| InChIKey | GCBABFCELKSUJI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.12 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |