C13H15Br2ClN4 — CID 114019567
[(3-bromo-5-chlorophenyl)-(4-bromo-1-propylpyrazol-5-yl)methyl]hydrazine (PubChem CID 114019567) has the molecular formula C13H15Br2ClN4 and a molecular weight of 422.55 g/mol. Its IUPAC name is [(3-bromo-5-chlorophenyl)-(4-bromo-1-propylpyrazol-5-yl)methyl]hydrazine.
| Compound Name | [(3-bromo-5-chlorophenyl)-(4-bromo-1-propylpyrazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 114019567 |
| Molecular Formula | C13H15Br2ClN4 |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 419.94 |
| IUPAC Name | [(3-bromo-5-chlorophenyl)-(4-bromo-1-propylpyrazol-5-yl)methyl]hydrazine |
| SMILES | CCCn1ncc(Br)c1C(NN)c1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C13H15Br2ClN4/c1-2-3-20-13(11(15)7-18-20)12(19-17)8-4-9(14)6-10(16)5-8/h4-7,12,19H,2-3,17H2,1H3 |
| InChIKey | NSJODVAZSSEXOP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|