C14H17NO2 — CID 11401994
(3R,3aS,6aR)-2-methyl-3-phenyl-4,5,6,6a-tetrahydro-3H-cyclopenta[d][1,2]oxazole-3a-carbaldehyde (PubChem CID 11401994) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is (3R,3aS,6aR)-2-methyl-3-phenyl-4,5,6,6a-tetrahydro-3H-cyclopenta[d][1,2]oxazole-3a-carbaldehyde.
| Compound Name | (3R,3aS,6aR)-2-methyl-3-phenyl-4,5,6,6a-tetrahydro-3H-cyclopenta[d][1,2]oxazole-3a-carbaldehyde |
|---|---|
| PubChem CID | 11401994 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (3R,3aS,6aR)-2-methyl-3-phenyl-4,5,6,6a-tetrahydro-3H-cyclopenta[d][1,2]oxazole-3a-carbaldehyde |
| SMILES | CN1O[C@@H]2CCC[C@]2(C=O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C14H17NO2/c1-15-13(11-6-3-2-4-7-11)14(10-16)9-5-8-12(14)17-15/h2-4,6-7,10,12-13H,5,8-9H2,1H3/t12-,13-,14-/m1/s1 |
| InChIKey | UESMNUDCTLHUAR-MGPQQGTHSA-N |
| XLogP | 2.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|