C11H11NO5 — CID 11402133
(3aS,4R,7aS)-4-(2-oxo-1,3-oxazolidin-3-yl)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione (PubChem CID 11402133) has the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. Its IUPAC name is (3aS,4R,7aS)-4-(2-oxo-1,3-oxazolidin-3-yl)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione.
| Compound Name | (3aS,4R,7aS)-4-(2-oxo-1,3-oxazolidin-3-yl)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 11402133 |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | (3aS,4R,7aS)-4-(2-oxo-1,3-oxazolidin-3-yl)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)[C@H]2CC=C[C@@H](N3CCOC3=O)[C@@H]12 |
| InChI | InChI=1S/C11H11NO5/c13-9-6-2-1-3-7(8(6)10(14)17-9)12-4-5-16-11(12)15/h1,3,6-8H,2,4-5H2/t6-,7+,8-/m0/s1 |
| InChIKey | XAFVNHZHJJBFAS-RNJXMRFFSA-N |
| XLogP | 0.08 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|