C13H18O4 — CID 11402162
ethyl (4aS,8aS)-3-methylidene-2-oxo-4,5,6,7,8,8a-hexahydrochromene-4a-carboxylate (PubChem CID 11402162) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is ethyl (4aS,8aS)-3-methylidene-2-oxo-4,5,6,7,8,8a-hexahydrochromene-4a-carboxylate.
| Compound Name | ethyl (4aS,8aS)-3-methylidene-2-oxo-4,5,6,7,8,8a-hexahydrochromene-4a-carboxylate |
|---|---|
| PubChem CID | 11402162 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | ethyl (4aS,8aS)-3-methylidene-2-oxo-4,5,6,7,8,8a-hexahydrochromene-4a-carboxylate |
| SMILES | C=C1C[C@@]2(C(=O)OCC)CCCC[C@@H]2OC1=O |
| InChI | InChI=1S/C13H18O4/c1-3-16-12(15)13-7-5-4-6-10(13)17-11(14)9(2)8-13/h10H,2-8H2,1H3/t10-,13-/m0/s1 |
| InChIKey | CRKLDQBHXQTENP-GWCFXTLKSA-N |
| XLogP | 1.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|