About tert-butyl (2E,7E)-8-nitroocta-2,7-dienoate
tert-butyl (2E,7E)-8-nitroocta-2,7-dienoate (PubChem CID 11402220) has the molecular formula C12H19NO4
and a molecular weight of 241.29 g/mol. Its IUPAC name is tert-butyl (2E,7E)-8-nitroocta-2,7-dienoate.
Molecular Properties
| Compound Name | tert-butyl (2E,7E)-8-nitroocta-2,7-dienoate |
| PubChem CID | 11402220 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | tert-butyl (2E,7E)-8-nitroocta-2,7-dienoate |
| SMILES | CC(C)(C)OC(=O)/C=C/CCC/C=C/[N+](=O)[O-] |
| InChI | InChI=1S/C12H19NO4/c1-12(2,3)17-11(14)9-7-5-4-6-8-10-13(15)16/h7-10H,4-6H2,1-3H3/b9-7+,10-8+ |
| InChIKey | GBHUHEHVCQRMTO-FIFLTTCUSA-N |
| XLogP | 2.85 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2E,7E)-8-nitroocta-2,7-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2E,7E)-8-nitroocta-2,7-dienoate?
The IUPAC name of tert-butyl (2E,7E)-8-nitroocta-2,7-dienoate (CID 11402220) is tert-butyl (2E,7E)-8-nitroocta-2,7-dienoate.
What is the SMILES notation for tert-butyl (2E,7E)-8-nitroocta-2,7-dienoate?
The canonical SMILES for tert-butyl (2E,7E)-8-nitroocta-2,7-dienoate is CC(C)(C)OC(=O)/C=C/CCC/C=C/[N+](=O)[O-].
What is the InChIKey of tert-butyl (2E,7E)-8-nitroocta-2,7-dienoate?
The InChIKey is GBHUHEHVCQRMTO-FIFLTTCUSA-N. The full InChI is InChI=1S/C12H19NO4/c1-12(2,3)17-11(14)9-7-5-4-6-8-10-13(15)16/h7-10H,4-6H2,1-3H3/b9-7+,10-8+.
What are the key properties of tert-butyl (2E,7E)-8-nitroocta-2,7-dienoate?
tert-butyl (2E,7E)-8-nitroocta-2,7-dienoate has a molecular weight of 241.29 g/mol, XLogP of 2.85, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2E,7E)-8-nitroocta-2,7-dienoate is sourced from PubChem (CID 11402220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).