About methyl (2E)-2-(2-acetyl-2-methoxy-5,5-dimethyl-1,3-dioxolan-4-ylidene)acetate
methyl (2E)-2-(2-acetyl-2-methoxy-5,5-dimethyl-1,3-dioxolan-4-ylidene)acetate (PubChem CID 11402276) has the molecular formula C11H16O6
and a molecular weight of 244.24 g/mol. Its IUPAC name is methyl (2E)-2-(2-acetyl-2-methoxy-5,5-dimethyl-1,3-dioxolan-4-ylidene)acetate.
Molecular Properties
| Compound Name | methyl (2E)-2-(2-acetyl-2-methoxy-5,5-dimethyl-1,3-dioxolan-4-ylidene)acetate |
| PubChem CID | 11402276 |
| Molecular Formula | C11H16O6 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | methyl (2E)-2-(2-acetyl-2-methoxy-5,5-dimethyl-1,3-dioxolan-4-ylidene)acetate |
| SMILES | COC(=O)/C=C1/OC(OC)(C(C)=O)OC1(C)C |
| InChI | InChI=1S/C11H16O6/c1-7(12)11(15-5)16-8(6-9(13)14-4)10(2,3)17-11/h6H,1-5H3/b8-6+ |
| InChIKey | XROMGPGIVQLKPP-SOFGYWHQSA-N |
| XLogP | 0.76 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (2E)-2-(2-acetyl-2-methoxy-5,5-dimethyl-1,3-dioxolan-4-ylidene)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2E)-2-(2-acetyl-2-methoxy-5,5-dimethyl-1,3-dioxolan-4-ylidene)acetate?
The IUPAC name of methyl (2E)-2-(2-acetyl-2-methoxy-5,5-dimethyl-1,3-dioxolan-4-ylidene)acetate (CID 11402276) is methyl (2E)-2-(2-acetyl-2-methoxy-5,5-dimethyl-1,3-dioxolan-4-ylidene)acetate.
What is the SMILES notation for methyl (2E)-2-(2-acetyl-2-methoxy-5,5-dimethyl-1,3-dioxolan-4-ylidene)acetate?
The canonical SMILES for methyl (2E)-2-(2-acetyl-2-methoxy-5,5-dimethyl-1,3-dioxolan-4-ylidene)acetate is COC(=O)/C=C1/OC(OC)(C(C)=O)OC1(C)C.
What is the InChIKey of methyl (2E)-2-(2-acetyl-2-methoxy-5,5-dimethyl-1,3-dioxolan-4-ylidene)acetate?
The InChIKey is XROMGPGIVQLKPP-SOFGYWHQSA-N. The full InChI is InChI=1S/C11H16O6/c1-7(12)11(15-5)16-8(6-9(13)14-4)10(2,3)17-11/h6H,1-5H3/b8-6+.
What are the key properties of methyl (2E)-2-(2-acetyl-2-methoxy-5,5-dimethyl-1,3-dioxolan-4-ylidene)acetate?
methyl (2E)-2-(2-acetyl-2-methoxy-5,5-dimethyl-1,3-dioxolan-4-ylidene)acetate has a molecular weight of 244.24 g/mol, XLogP of 0.76, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2E)-2-(2-acetyl-2-methoxy-5,5-dimethyl-1,3-dioxolan-4-ylidene)acetate is sourced from PubChem (CID 11402276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).