C15H8Br2OS — CID 114023487
1-benzothiophen-3-yl-(3,5-dibromophenyl)methanone (PubChem CID 114023487) has the molecular formula C15H8Br2OS and a molecular weight of 396.10 g/mol. Its IUPAC name is 1-benzothiophen-3-yl-(3,5-dibromophenyl)methanone.
| Compound Name | 1-benzothiophen-3-yl-(3,5-dibromophenyl)methanone |
|---|---|
| PubChem CID | 114023487 |
| Molecular Formula | C15H8Br2OS |
| Molecular Weight | 396.10 g/mol |
| Exact Mass | 393.87 |
| IUPAC Name | 1-benzothiophen-3-yl-(3,5-dibromophenyl)methanone |
| SMILES | O=C(c1cc(Br)cc(Br)c1)c1csc2ccccc12 |
| InChI | InChI=1S/C15H8Br2OS/c16-10-5-9(6-11(17)7-10)15(18)13-8-19-14-4-2-1-3-12(13)14/h1-8H |
| InChIKey | BNVSMHRNJICMEZ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.10 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |