About N-oct-2-ynylnona-1,8-dien-5-amine
N-oct-2-ynylnona-1,8-dien-5-amine (PubChem CID 11402374) has the molecular formula C17H29N
and a molecular weight of 247.43 g/mol. Its IUPAC name is N-oct-2-ynylnona-1,8-dien-5-amine.
Molecular Properties
| Compound Name | N-oct-2-ynylnona-1,8-dien-5-amine |
| PubChem CID | 11402374 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | N-oct-2-ynylnona-1,8-dien-5-amine |
| SMILES | C=CCCC(CCC=C)NCC#CCCCCC |
| InChI | InChI=1S/C17H29N/c1-4-7-10-11-12-13-16-18-17(14-8-5-2)15-9-6-3/h5-6,17-18H,2-4,7-11,14-16H2,1H3 |
| InChIKey | SGZWKFQJTJAQQA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-oct-2-ynylnona-1,8-dien-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-oct-2-ynylnona-1,8-dien-5-amine?
The IUPAC name of N-oct-2-ynylnona-1,8-dien-5-amine (CID 11402374) is N-oct-2-ynylnona-1,8-dien-5-amine.
What is the SMILES notation for N-oct-2-ynylnona-1,8-dien-5-amine?
The canonical SMILES for N-oct-2-ynylnona-1,8-dien-5-amine is C=CCCC(CCC=C)NCC#CCCCCC.
What is the InChIKey of N-oct-2-ynylnona-1,8-dien-5-amine?
The InChIKey is SGZWKFQJTJAQQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N/c1-4-7-10-11-12-13-16-18-17(14-8-5-2)15-9-6-3/h5-6,17-18H,2-4,7-11,14-16H2,1H3.
What are the key properties of N-oct-2-ynylnona-1,8-dien-5-amine?
N-oct-2-ynylnona-1,8-dien-5-amine has a molecular weight of 247.43 g/mol, XLogP of 4.46, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-oct-2-ynylnona-1,8-dien-5-amine is sourced from PubChem (CID 11402374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).