C15H20O3 — CID 11402456
2-(3,3-dimethyloxiran-2-yl)ethyl 3-phenylpropan(18O)oate (PubChem CID 11402456) has the molecular formula C15H20O3 and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-(3,3-dimethyloxiran-2-yl)ethyl 3-phenylpropan(18O)oate.
| Compound Name | 2-(3,3-dimethyloxiran-2-yl)ethyl 3-phenylpropan(18O)oate |
|---|---|
| PubChem CID | 11402456 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 2-(3,3-dimethyloxiran-2-yl)ethyl 3-phenylpropan(18O)oate |
| SMILES | CC1(C)OC1CCOC(=[18O])CCc1ccccc1 |
| InChI | InChI=1S/C15H20O3/c1-15(2)13(18-15)10-11-17-14(16)9-8-12-6-4-3-5-7-12/h3-7,13H,8-11H2,1-2H3/i16+2 |
| InChIKey | RJDOYPBFFZJLBY-VPMSBSONSA-N |
| XLogP | 2.73 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|