About 4-methylidene-1,6-bis(trimethylsilyl)hexa-1,5-diyn-3-ol
4-methylidene-1,6-bis(trimethylsilyl)hexa-1,5-diyn-3-ol (PubChem CID 11402468) has the molecular formula C13H22OSi2
and a molecular weight of 250.49 g/mol. Its IUPAC name is 4-methylidene-1,6-bis(trimethylsilyl)hexa-1,5-diyn-3-ol.
Molecular Properties
| Compound Name | 4-methylidene-1,6-bis(trimethylsilyl)hexa-1,5-diyn-3-ol |
| PubChem CID | 11402468 |
| Molecular Formula | C13H22OSi2 |
| Molecular Weight | 250.49 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 4-methylidene-1,6-bis(trimethylsilyl)hexa-1,5-diyn-3-ol |
| SMILES | C=C(C#C[Si](C)(C)C)C(O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C13H22OSi2/c1-12(8-10-15(2,3)4)13(14)9-11-16(5,6)7/h13-14H,1H2,2-7H3 |
| InChIKey | CRXDFEUBARNBGA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methylidene-1,6-bis(trimethylsilyl)hexa-1,5-diyn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylidene-1,6-bis(trimethylsilyl)hexa-1,5-diyn-3-ol?
The IUPAC name of 4-methylidene-1,6-bis(trimethylsilyl)hexa-1,5-diyn-3-ol (CID 11402468) is 4-methylidene-1,6-bis(trimethylsilyl)hexa-1,5-diyn-3-ol.
What is the SMILES notation for 4-methylidene-1,6-bis(trimethylsilyl)hexa-1,5-diyn-3-ol?
The canonical SMILES for 4-methylidene-1,6-bis(trimethylsilyl)hexa-1,5-diyn-3-ol is C=C(C#C[Si](C)(C)C)C(O)C#C[Si](C)(C)C.
What is the InChIKey of 4-methylidene-1,6-bis(trimethylsilyl)hexa-1,5-diyn-3-ol?
The InChIKey is CRXDFEUBARNBGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22OSi2/c1-12(8-10-15(2,3)4)13(14)9-11-16(5,6)7/h13-14H,1H2,2-7H3.
What are the key properties of 4-methylidene-1,6-bis(trimethylsilyl)hexa-1,5-diyn-3-ol?
4-methylidene-1,6-bis(trimethylsilyl)hexa-1,5-diyn-3-ol has a molecular weight of 250.49 g/mol, XLogP of 2.67, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylidene-1,6-bis(trimethylsilyl)hexa-1,5-diyn-3-ol is sourced from PubChem (CID 11402468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).