4-chloro-2-(1,3-dihydro-2-benzofuran-5-yl)benzoic acid

C15H11ClO3 — CID 114024739

IUPAC4-chloro-2-(1,3-dihydro-2-benzofuran-5-yl)benzoic acid
SMILESO=C(O)c1ccc(Cl)cc1-c1ccc2c(c1)COC2
InChIInChI=1S/C15H11ClO3/c16-12-3-4-13(15(17)18)14(6-12)9-1-2-10-7-19-8-11(10)5-9/h1-6H,7-8H2,(H,17,18)
InChIKeyXXLMADXYDBTMBL-UHFFFAOYSA-N
MW274.70 g/mol
LogP3.74
Rot. Bonds2

About 4-chloro-2-(1,3-dihydro-2-benzofuran-5-yl)benzoic acid

4-chloro-2-(1,3-dihydro-2-benzofuran-5-yl)benzoic acid (PubChem CID 114024739) has the molecular formula C15H11ClO3 and a molecular weight of 274.70 g/mol. Its IUPAC name is 4-chloro-2-(1,3-dihydro-2-benzofuran-5-yl)benzoic acid.

Molecular Properties

Compound Name4-chloro-2-(1,3-dihydro-2-benzofuran-5-yl)benzoic acid
PubChem CID114024739
Molecular FormulaC15H11ClO3
Molecular Weight274.70 g/mol
Exact Mass274.04
IUPAC Name4-chloro-2-(1,3-dihydro-2-benzofuran-5-yl)benzoic acid
SMILESO=C(O)c1ccc(Cl)cc1-c1ccc2c(c1)COC2
InChIInChI=1S/C15H11ClO3/c16-12-3-4-13(15(17)18)14(6-12)9-1-2-10-7-19-8-11(10)5-9/h1-6H,7-8H2,(H,17,18)
InChIKeyXXLMADXYDBTMBL-UHFFFAOYSA-N
XLogP3.74
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.70
LogP ≤ 53.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-chloro-2-(1,3-dihydro-2-benzofuran-5-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-chloro-2-(1,3-dihydro-2-benzofuran-5-yl)benzoic acid?
The IUPAC name of 4-chloro-2-(1,3-dihydro-2-benzofuran-5-yl)benzoic acid (CID 114024739) is 4-chloro-2-(1,3-dihydro-2-benzofuran-5-yl)benzoic acid.
What is the SMILES notation for 4-chloro-2-(1,3-dihydro-2-benzofuran-5-yl)benzoic acid?
The canonical SMILES for 4-chloro-2-(1,3-dihydro-2-benzofuran-5-yl)benzoic acid is O=C(O)c1ccc(Cl)cc1-c1ccc2c(c1)COC2.
What is the InChIKey of 4-chloro-2-(1,3-dihydro-2-benzofuran-5-yl)benzoic acid?
The InChIKey is XXLMADXYDBTMBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClO3/c16-12-3-4-13(15(17)18)14(6-12)9-1-2-10-7-19-8-11(10)5-9/h1-6H,7-8H2,(H,17,18).
What are the key properties of 4-chloro-2-(1,3-dihydro-2-benzofuran-5-yl)benzoic acid?
4-chloro-2-(1,3-dihydro-2-benzofuran-5-yl)benzoic acid has a molecular weight of 274.70 g/mol, XLogP of 3.74, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(1,3-dihydro-2-benzofuran-5-yl)benzoic acid is sourced from PubChem (CID 114024739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).