About N-dec-9-enyl-2,2,2-trifluoroacetamide
N-dec-9-enyl-2,2,2-trifluoroacetamide (PubChem CID 11402486) has the molecular formula C12H20F3NO
and a molecular weight of 251.29 g/mol. Its IUPAC name is N-dec-9-enyl-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-dec-9-enyl-2,2,2-trifluoroacetamide |
| PubChem CID | 11402486 |
| Molecular Formula | C12H20F3NO |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N-dec-9-enyl-2,2,2-trifluoroacetamide |
| SMILES | C=CCCCCCCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H20F3NO/c1-2-3-4-5-6-7-8-9-10-16-11(17)12(13,14)15/h2H,1,3-10H2,(H,16,17) |
| InChIKey | XYRSNIPQOBJXDR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-dec-9-enyl-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-dec-9-enyl-2,2,2-trifluoroacetamide?
The IUPAC name of N-dec-9-enyl-2,2,2-trifluoroacetamide (CID 11402486) is N-dec-9-enyl-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-dec-9-enyl-2,2,2-trifluoroacetamide?
The canonical SMILES for N-dec-9-enyl-2,2,2-trifluoroacetamide is C=CCCCCCCCCNC(=O)C(F)(F)F.
What is the InChIKey of N-dec-9-enyl-2,2,2-trifluoroacetamide?
The InChIKey is XYRSNIPQOBJXDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F3NO/c1-2-3-4-5-6-7-8-9-10-16-11(17)12(13,14)15/h2H,1,3-10H2,(H,16,17).
What are the key properties of N-dec-9-enyl-2,2,2-trifluoroacetamide?
N-dec-9-enyl-2,2,2-trifluoroacetamide has a molecular weight of 251.29 g/mol, XLogP of 3.58, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-dec-9-enyl-2,2,2-trifluoroacetamide is sourced from PubChem (CID 11402486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).